C16H17F3N2O3S — CID 69268949
2-(trifluoromethyl)-4-[(1S,2S,6R,7R,9R)-3,3,9-trihydroxy-3λ4-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzonitrile (PubChem CID 69268949) has the molecular formula C16H17F3N2O3S and a molecular weight of 374.38 g/mol. Its IUPAC name is 2-(trifluoromethyl)-4-[(1S,2S,6R,7R,9R)-3,3,9-trihydroxy-3λ4-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzonitrile.
| Compound Name | 2-(trifluoromethyl)-4-[(1S,2S,6R,7R,9R)-3,3,9-trihydroxy-3λ4-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzonitrile |
|---|---|
| PubChem CID | 69268949 |
| Molecular Formula | C16H17F3N2O3S |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 2-(trifluoromethyl)-4-[(1S,2S,6R,7R,9R)-3,3,9-trihydroxy-3λ4-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2C[C@H]3[C@@H]4C[C@H]([C@H]3S2(O)O)[C@H](O)C4)cc1C(F)(F)F |
| InChI | InChI=1S/C16H17F3N2O3S/c17-16(18,19)13-5-10(2-1-8(13)6-20)21-7-12-9-3-11(14(22)4-9)15(12)25(21,23)24/h1-2,5,9,11-12,14-15,22-24H,3-4,7H2/t9-,11+,12+,14-,15-/m1/s1 |
| InChIKey | YSEAQZBTDVTNQU-BRIGZHOFSA-N |
| XLogP | 3.45 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |