C15H15F3N2O3S — CID 68511094
4-[(1S,2R,6R,7R)-3,3-dihydroxy-10-oxa-3λ4-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 68511094) has the molecular formula C15H15F3N2O3S and a molecular weight of 360.36 g/mol. Its IUPAC name is 4-[(1S,2R,6R,7R)-3,3-dihydroxy-10-oxa-3λ4-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1S,2R,6R,7R)-3,3-dihydroxy-10-oxa-3λ4-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 68511094 |
| Molecular Formula | C15H15F3N2O3S |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 4-[(1S,2R,6R,7R)-3,3-dihydroxy-10-oxa-3λ4-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2C[C@H]3[C@H]([C@@H]4CC[C@H]3O4)S2(O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C15H15F3N2O3S/c16-15(17,18)11-5-9(2-1-8(11)6-19)20-7-10-12-3-4-13(23-12)14(10)24(20,21)22/h1-2,5,10,12-14,21-22H,3-4,7H2/t10-,12-,13+,14-/m1/s1 |
| InChIKey | BZTJZVQBNNXUAZ-RUZUBIRVSA-N |
| XLogP | 3.61 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |