C15H14F3N3O3S — CID 68506593
4-[(1R,2R,6R,7S,9R)-9-amino-3,3-dioxo-10-oxa-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 68506593) has the molecular formula C15H14F3N3O3S and a molecular weight of 373.36 g/mol. Its IUPAC name is 4-[(1R,2R,6R,7S,9R)-9-amino-3,3-dioxo-10-oxa-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1R,2R,6R,7S,9R)-9-amino-3,3-dioxo-10-oxa-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 68506593 |
| Molecular Formula | C15H14F3N3O3S |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 4-[(1R,2R,6R,7S,9R)-9-amino-3,3-dioxo-10-oxa-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2C[C@H]3[C@H]([C@@H]4O[C@H]3C[C@H]4N)S2(=O)=O)cc1C(F)(F)F |
| InChI | InChI=1S/C15H14F3N3O3S/c16-15(17,18)10-3-8(2-1-7(10)5-19)21-6-9-12-4-11(20)13(24-12)14(9)25(21,22)23/h1-3,9,11-14H,4,6,20H2/t9-,11-,12+,13-,14-/m1/s1 |
| InChIKey | VPIJKAYRPMHNGE-RGCYKPLRSA-N |
| XLogP | 1.21 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |