C25H26F3N3O2S — CID 143641164
acetylene;4-[(1S,2R,6R,7S)-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile;phenylmethanamine (PubChem CID 143641164) has the molecular formula C25H26F3N3O2S and a molecular weight of 489.56 g/mol. Its IUPAC name is acetylene;4-[(1S,2R,6R,7S)-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile;phenylmethanamine.
| Compound Name | acetylene;4-[(1S,2R,6R,7S)-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile;phenylmethanamine |
|---|---|
| PubChem CID | 143641164 |
| Molecular Formula | C25H26F3N3O2S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | acetylene;4-[(1S,2R,6R,7S)-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile;phenylmethanamine |
| SMILES | C#C.N#Cc1ccc(N2C[C@H]3[C@H]4CC[C@@H](C4)[C@H]3S2(=O)=O)cc1C(F)(F)F.NCc1ccccc1 |
| InChI | InChI=1S/C16H15F3N2O2S.C7H9N.C2H2/c17-16(18,19)14-6-12(4-3-11(14)7-20)21-8-13-9-1-2-10(5-9)15(13)24(21,22)23;8-6-7-4-2-1-3-5-7;1-2/h3-4,6,9-10,13,15H,1-2,5,8H2;1-5H,6,8H2;1-2H/t9-,10-,13-,15+;;/m0../s1 |
| InChIKey | OCPFWCJKJHGMDB-HXOUCICPSA-N |
| XLogP | 4.54 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|