C17H19F3N2O3S — CID 69267406
2-(trifluoromethyl)-4-[(1R,2R,5S,6S,7S,9R)-3,3,9-trihydroxy-5-methyl-3λ4-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzonitrile (PubChem CID 69267406) has the molecular formula C17H19F3N2O3S and a molecular weight of 388.41 g/mol. Its IUPAC name is 2-(trifluoromethyl)-4-[(1R,2R,5S,6S,7S,9R)-3,3,9-trihydroxy-5-methyl-3λ4-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzonitrile.
| Compound Name | 2-(trifluoromethyl)-4-[(1R,2R,5S,6S,7S,9R)-3,3,9-trihydroxy-5-methyl-3λ4-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzonitrile |
|---|---|
| PubChem CID | 69267406 |
| Molecular Formula | C17H19F3N2O3S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 2-(trifluoromethyl)-4-[(1R,2R,5S,6S,7S,9R)-3,3,9-trihydroxy-5-methyl-3λ4-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzonitrile |
| SMILES | C[C@H]1[C@@H]2[C@H]3C[C@@H]([C@@H]2S(O)(O)N1c1ccc(C#N)c(C(F)(F)F)c1)[C@H](O)C3 |
| InChI | InChI=1S/C17H19F3N2O3S/c1-8-15-10-4-12(14(23)5-10)16(15)26(24,25)22(8)11-3-2-9(7-21)13(6-11)17(18,19)20/h2-3,6,8,10,12,14-16,23-25H,4-5H2,1H3/t8-,10-,12+,14+,15+,16-/m0/s1 |
| InChIKey | SUTAWLUNMHAGNQ-XUZSCVEJSA-N |
| XLogP | 3.84 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |