C16H15F3N2O3S — CID 68508178
4-[(1S,2S,6S,7R)-3,3-dihydroxy-2-methyl-10-oxa-3λ4-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 68508178) has the molecular formula C16H15F3N2O3S and a molecular weight of 372.37 g/mol. Its IUPAC name is 4-[(1S,2S,6S,7R)-3,3-dihydroxy-2-methyl-10-oxa-3λ4-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1S,2S,6S,7R)-3,3-dihydroxy-2-methyl-10-oxa-3λ4-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 68508178 |
| Molecular Formula | C16H15F3N2O3S |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 4-[(1S,2S,6S,7R)-3,3-dihydroxy-2-methyl-10-oxa-3λ4-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C[C@@]12[C@@H]3C=C[C@@H](O3)[C@@H]1CN(c1ccc(C#N)c(C(F)(F)F)c1)S2(O)O |
| InChI | InChI=1S/C16H15F3N2O3S/c1-15-12(13-4-5-14(15)24-13)8-21(25(15,22)23)10-3-2-9(7-20)11(6-10)16(17,18)19/h2-6,12-14,22-23H,8H2,1H3/t12-,13+,14-,15-/m0/s1 |
| InChIKey | ARUUKRFEABCAAP-XGUBFFRZSA-N |
| XLogP | 3.77 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|