C18H21F3N2O3S — CID 69267449
4-[(1R,2R,6R,7S)-3,3-dihydroxy-2-(methoxymethyl)-3λ4-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 69267449) has the molecular formula C18H21F3N2O3S and a molecular weight of 402.44 g/mol. Its IUPAC name is 4-[(1R,2R,6R,7S)-3,3-dihydroxy-2-(methoxymethyl)-3λ4-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1R,2R,6R,7S)-3,3-dihydroxy-2-(methoxymethyl)-3λ4-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 69267449 |
| Molecular Formula | C18H21F3N2O3S |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 4-[(1R,2R,6R,7S)-3,3-dihydroxy-2-(methoxymethyl)-3λ4-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | COC[C@@]12[C@@H]3CC[C@@H](C3)[C@@H]1CN(c1ccc(C#N)c(C(F)(F)F)c1)S2(O)O |
| InChI | InChI=1S/C18H21F3N2O3S/c1-26-10-17-13-4-2-11(6-13)16(17)9-23(27(17,24)25)14-5-3-12(8-22)15(7-14)18(19,20)21/h3,5,7,11,13,16,24-25H,2,4,6,9-10H2,1H3/t11-,13+,16-,17+/m0/s1 |
| InChIKey | DZXPIFMBRFXHKE-YCCRMZCTSA-N |
| XLogP | 4.49 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |