C18H18F3N3O4S — CID 69277916
[(1R,2R,6R,7S)-4-[4-cyano-3-(trifluoromethyl)phenyl]-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-2-yl]methylcarbamic acid (PubChem CID 69277916) has the molecular formula C18H18F3N3O4S and a molecular weight of 429.42 g/mol. Its IUPAC name is [(1R,2R,6R,7S)-4-[4-cyano-3-(trifluoromethyl)phenyl]-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-2-yl]methylcarbamic acid.
| Compound Name | [(1R,2R,6R,7S)-4-[4-cyano-3-(trifluoromethyl)phenyl]-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-2-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 69277916 |
| Molecular Formula | C18H18F3N3O4S |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | [(1R,2R,6R,7S)-4-[4-cyano-3-(trifluoromethyl)phenyl]-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-2-yl]methylcarbamic acid |
| SMILES | N#Cc1ccc(N2C[C@H]3[C@H]4CC[C@H](C4)[C@@]3(CNC(=O)O)S2(=O)=O)cc1C(F)(F)F |
| InChI | InChI=1S/C18H18F3N3O4S/c19-18(20,21)14-6-13(4-2-11(14)7-22)24-8-15-10-1-3-12(5-10)17(15,29(24,27)28)9-23-16(25)26/h2,4,6,10,12,15,23H,1,3,5,8-9H2,(H,25,26)/t10-,12+,15-,17+/m0/s1 |
| InChIKey | MXZWCNUPEOQNCE-AGLBBYSZSA-N |
| XLogP | 2.78 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |