C19H22F3N3O4S2 — CID 69275686
N-[[(1R,2R,6R,7S)-4-[4-cyano-3-(trifluoromethyl)phenyl]-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-2-yl]methyl]ethanesulfonamide (PubChem CID 69275686) has the molecular formula C19H22F3N3O4S2 and a molecular weight of 477.53 g/mol. Its IUPAC name is N-[[(1R,2R,6R,7S)-4-[4-cyano-3-(trifluoromethyl)phenyl]-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-2-yl]methyl]ethanesulfonamide.
| Compound Name | N-[[(1R,2R,6R,7S)-4-[4-cyano-3-(trifluoromethyl)phenyl]-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-2-yl]methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 69275686 |
| Molecular Formula | C19H22F3N3O4S2 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | N-[[(1R,2R,6R,7S)-4-[4-cyano-3-(trifluoromethyl)phenyl]-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-2-yl]methyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC[C@@]12[C@@H]3CC[C@@H](C3)[C@@H]1CN(c1ccc(C#N)c(C(F)(F)F)c1)S2(=O)=O |
| InChI | InChI=1S/C19H22F3N3O4S2/c1-2-30(26,27)24-11-18-14-5-3-12(7-14)17(18)10-25(31(18,28)29)15-6-4-13(9-23)16(8-15)19(20,21)22/h4,6,8,12,14,17,24H,2-3,5,7,10-11H2,1H3/t12-,14+,17-,18+/m0/s1 |
| InChIKey | HCTHPEOZLOTUKC-BAGBSZHRSA-N |
| XLogP | 2.45 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |