C18H17F3N2O3S — CID 59707234
4-[(1R,2R,6R,7S)-2-(methoxymethyl)-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 59707234) has the molecular formula C18H17F3N2O3S and a molecular weight of 398.41 g/mol. Its IUPAC name is 4-[(1R,2R,6R,7S)-2-(methoxymethyl)-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1R,2R,6R,7S)-2-(methoxymethyl)-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 59707234 |
| Molecular Formula | C18H17F3N2O3S |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 4-[(1R,2R,6R,7S)-2-(methoxymethyl)-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | COC[C@@]12[C@H]3C=C[C@H](C3)[C@@H]1CN(c1ccc(C#N)c(C(F)(F)F)c1)S2(=O)=O |
| InChI | InChI=1S/C18H17F3N2O3S/c1-26-10-17-13-4-2-11(6-13)16(17)9-23(27(17,24)25)14-5-3-12(8-22)15(7-14)18(19,20)21/h2-5,7,11,13,16H,6,9-10H2,1H3/t11-,13+,16+,17-/m1/s1 |
| InChIKey | MRXHJZVOEKXAGH-NYUZSIGZSA-N |
| XLogP | 2.93 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|