C19H19F3N2O3S — CID 162584480
4-[(1S,2R,6R,7R)-2-(2-methoxyethyl)-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 162584480) has the molecular formula C19H19F3N2O3S and a molecular weight of 412.43 g/mol. Its IUPAC name is 4-[(1S,2R,6R,7R)-2-(2-methoxyethyl)-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1S,2R,6R,7R)-2-(2-methoxyethyl)-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 162584480 |
| Molecular Formula | C19H19F3N2O3S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 4-[(1S,2R,6R,7R)-2-(2-methoxyethyl)-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | COCC[C@@]12[C@@H]3C=C[C@@H](C3)[C@@H]1CN(c1ccc(C#N)c(C(F)(F)F)c1)S2(=O)=O |
| InChI | InChI=1S/C19H19F3N2O3S/c1-27-7-6-18-14-4-2-12(8-14)17(18)11-24(28(18,25)26)15-5-3-13(10-23)16(9-15)19(20,21)22/h2-5,9,12,14,17H,6-8,11H2,1H3/t12-,14+,17-,18+/m0/s1 |
| InChIKey | GNBYTUBWERCSFM-BAGBSZHRSA-N |
| XLogP | 3.32 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|