C19H17F3N2O4S — CID 71046496
ethyl (1S,2R,6R,7R)-4-[4-cyano-3-(trifluoromethyl)phenyl]-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-ene-2-carboxylate (PubChem CID 71046496) has the molecular formula C19H17F3N2O4S and a molecular weight of 426.42 g/mol. Its IUPAC name is ethyl (1S,2R,6R,7R)-4-[4-cyano-3-(trifluoromethyl)phenyl]-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-ene-2-carboxylate.
| Compound Name | ethyl (1S,2R,6R,7R)-4-[4-cyano-3-(trifluoromethyl)phenyl]-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-ene-2-carboxylate |
|---|---|
| PubChem CID | 71046496 |
| Molecular Formula | C19H17F3N2O4S |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | ethyl (1S,2R,6R,7R)-4-[4-cyano-3-(trifluoromethyl)phenyl]-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-ene-2-carboxylate |
| SMILES | CCOC(=O)[C@@]12[C@@H]3C=C[C@@H](C3)[C@@H]1CN(c1ccc(C#N)c(C(F)(F)F)c1)S2(=O)=O |
| InChI | InChI=1S/C19H17F3N2O4S/c1-2-28-17(25)18-13-5-3-11(7-13)16(18)10-24(29(18,26)27)14-6-4-12(9-23)15(8-14)19(20,21)22/h3-6,8,11,13,16H,2,7,10H2,1H3/t11-,13+,16-,18+/m0/s1 |
| InChIKey | MPHYZZHDZUXZTF-QRKZQPCCSA-N |
| XLogP | 2.85 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|