C19H21F3N2O2S — CID 71046747
4-[(1R,2R,6R,7S)-5-ethyl-2-methyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 71046747) has the molecular formula C19H21F3N2O2S and a molecular weight of 398.45 g/mol. Its IUPAC name is 4-[(1R,2R,6R,7S)-5-ethyl-2-methyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1R,2R,6R,7S)-5-ethyl-2-methyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 71046747 |
| Molecular Formula | C19H21F3N2O2S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 4-[(1R,2R,6R,7S)-5-ethyl-2-methyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CCC1[C@H]2[C@H]3CC[C@H](C3)[C@@]2(C)S(=O)(=O)N1c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H21F3N2O2S/c1-3-16-17-11-4-6-13(8-11)18(17,2)27(25,26)24(16)14-7-5-12(10-23)15(9-14)19(20,21)22/h5,7,9,11,13,16-17H,3-4,6,8H2,1-2H3/t11-,13+,16?,17+,18+/m0/s1 |
| InChIKey | UOLORZLEUYZWGD-IHQAXTCDSA-N |
| XLogP | 4.31 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |