C21H25F3N2O2S — CID 162584483
4-[(1R,2R,5R,6R,7S)-5-butyl-2-methyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 162584483) has the molecular formula C21H25F3N2O2S and a molecular weight of 426.50 g/mol. Its IUPAC name is 4-[(1R,2R,5R,6R,7S)-5-butyl-2-methyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1R,2R,5R,6R,7S)-5-butyl-2-methyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 162584483 |
| Molecular Formula | C21H25F3N2O2S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 4-[(1R,2R,5R,6R,7S)-5-butyl-2-methyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CCCC[C@@H]1[C@H]2[C@H]3CC[C@H](C3)[C@@]2(C)S(=O)(=O)N1c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H25F3N2O2S/c1-3-4-5-18-19-13-6-8-15(10-13)20(19,2)29(27,28)26(18)16-9-7-14(12-25)17(11-16)21(22,23)24/h7,9,11,13,15,18-19H,3-6,8,10H2,1-2H3/t13-,15+,18+,19+,20+/m0/s1 |
| InChIKey | MABYVKBXSPZOKU-CWYSQHEVSA-N |
| XLogP | 5.09 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |