C21H27F3N4O3S — CID 69277102
1-[(1S,2R,6R,7S,8R)-4-[4-cyano-3-(trifluoromethyl)phenyl]-3,3-dihydroxy-2-methyl-3λ4-thia-4-azatricyclo[5.2.1.02,6]decan-8-yl]-3-propan-2-ylurea (PubChem CID 69277102) has the molecular formula C21H27F3N4O3S and a molecular weight of 472.53 g/mol. Its IUPAC name is 1-[(1S,2R,6R,7S,8R)-4-[4-cyano-3-(trifluoromethyl)phenyl]-3,3-dihydroxy-2-methyl-3λ4-thia-4-azatricyclo[5.2.1.02,6]decan-8-yl]-3-propan-2-ylurea.
| Compound Name | 1-[(1S,2R,6R,7S,8R)-4-[4-cyano-3-(trifluoromethyl)phenyl]-3,3-dihydroxy-2-methyl-3λ4-thia-4-azatricyclo[5.2.1.02,6]decan-8-yl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 69277102 |
| Molecular Formula | C21H27F3N4O3S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 1-[(1S,2R,6R,7S,8R)-4-[4-cyano-3-(trifluoromethyl)phenyl]-3,3-dihydroxy-2-methyl-3λ4-thia-4-azatricyclo[5.2.1.02,6]decan-8-yl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)N[C@@H]1C[C@@H]2C[C@H]1[C@@H]1CN(c3ccc(C#N)c(C(F)(F)F)c3)S(O)(O)[C@]21C |
| InChI | InChI=1S/C21H27F3N4O3S/c1-11(2)26-19(29)27-18-7-13-6-15(18)17-10-28(32(30,31)20(13,17)3)14-5-4-12(9-25)16(8-14)21(22,23)24/h4-5,8,11,13,15,17-18,30-31H,6-7,10H2,1-3H3,(H2,26,27,29)/t13-,15-,17-,18+,20+/m0/s1 |
| InChIKey | VBMXDBUSDQIEEJ-DZKZAWRRSA-N |
| XLogP | 4.55 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |