C23H17F3N4O3S — CID 71051582
4-[(1R,6S)-3,5-dioxo-8-(2-phenylsulfanylacetyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 71051582) has the molecular formula C23H17F3N4O3S and a molecular weight of 486.48 g/mol. Its IUPAC name is 4-[(1R,6S)-3,5-dioxo-8-(2-phenylsulfanylacetyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1R,6S)-3,5-dioxo-8-(2-phenylsulfanylacetyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 71051582 |
| Molecular Formula | C23H17F3N4O3S |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 4-[(1R,6S)-3,5-dioxo-8-(2-phenylsulfanylacetyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)[C@@H]3C4C[C@H](CN4C(=O)CSc4ccccc4)N3C2=O)cc1C(F)(F)F |
| InChI | InChI=1S/C23H17F3N4O3S/c24-23(25,26)17-8-14(7-6-13(17)10-27)30-21(32)20-18-9-15(29(20)22(30)33)11-28(18)19(31)12-34-16-4-2-1-3-5-16/h1-8,15,18,20H,9,11-12H2/t15-,18?,20+/m1/s1 |
| InChIKey | IREWZTQFTKNYHI-BIYUGTDDSA-N |
| XLogP | 3.49 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|