C17H12F6N4O4S — CID 87778835
4-[(1S,6R,7S)-3,5-dioxo-8-(2,2,2-trifluoroethylsulfonyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 87778835) has the molecular formula C17H12F6N4O4S and a molecular weight of 482.36 g/mol. Its IUPAC name is 4-[(1S,6R,7S)-3,5-dioxo-8-(2,2,2-trifluoroethylsulfonyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1S,6R,7S)-3,5-dioxo-8-(2,2,2-trifluoroethylsulfonyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 87778835 |
| Molecular Formula | C17H12F6N4O4S |
| Molecular Weight | 482.36 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | 4-[(1S,6R,7S)-3,5-dioxo-8-(2,2,2-trifluoroethylsulfonyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)[C@H]3[C@@H]4C[C@@H](CN4S(=O)(=O)CC(F)(F)F)N3C2=O)cc1C(F)(F)F |
| InChI | InChI=1S/C17H12F6N4O4S/c18-16(19,20)7-32(30,31)25-6-10-4-12(25)13-14(28)27(15(29)26(10)13)9-2-1-8(5-24)11(3-9)17(21,22)23/h1-3,10,12-13H,4,6-7H2/t10-,12-,13+/m0/s1 |
| InChIKey | TUVQJJSBSGCNKE-WCFLWFBJSA-N |
| XLogP | 2.06 |
| TPSA | 101.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|