C20H10F12N4O3 — CID 58595600
4-[(1R,6R)-8-(2,2,3,3,4,4,5,5,5-nonafluoropentanoyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 58595600) has the molecular formula C20H10F12N4O3 and a molecular weight of 582.30 g/mol. Its IUPAC name is 4-[(1R,6R)-8-(2,2,3,3,4,4,5,5,5-nonafluoropentanoyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1R,6R)-8-(2,2,3,3,4,4,5,5,5-nonafluoropentanoyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 58595600 |
| Molecular Formula | C20H10F12N4O3 |
| Molecular Weight | 582.30 g/mol |
| Exact Mass | 582.06 |
| IUPAC Name | 4-[(1R,6R)-8-(2,2,3,3,4,4,5,5,5-nonafluoropentanoyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)[C@H]3C4C[C@H](CN4C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)N3C2=O)cc1C(F)(F)F |
| InChI | InChI=1S/C20H10F12N4O3/c21-16(22,18(26,27)19(28,29)20(30,31)32)14(38)34-6-9-4-11(34)12-13(37)36(15(39)35(9)12)8-2-1-7(5-33)10(3-8)17(23,24)25/h1-3,9,11-12H,4,6H2/t9-,11?,12-/m1/s1 |
| InChIKey | BYKBEJKOJYPJDQ-WSXXKJPRSA-N |
| XLogP | 4.17 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|