C23H12ClF15N4O3 — CID 58595700
2-chloro-4-[(1R,6R)-3,5-dioxo-8-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbenzonitrile (PubChem CID 58595700) has the molecular formula C23H12ClF15N4O3 and a molecular weight of 712.80 g/mol. Its IUPAC name is 2-chloro-4-[(1R,6R)-3,5-dioxo-8-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbenzonitrile.
| Compound Name | 2-chloro-4-[(1R,6R)-3,5-dioxo-8-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 58595700 |
| Molecular Formula | C23H12ClF15N4O3 |
| Molecular Weight | 712.80 g/mol |
| Exact Mass | 712.04 |
| IUPAC Name | 2-chloro-4-[(1R,6R)-3,5-dioxo-8-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbenzonitrile |
| SMILES | Cc1c(N2C(=O)[C@H]3C4C[C@H](CN4C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)N3C2=O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C23H12ClF15N4O3/c1-7-10(3-2-8(5-40)12(7)24)43-14(44)13-11-4-9(42(13)16(43)46)6-41(11)15(45)17(25,26)18(27,28)19(29,30)20(31,32)21(33,34)22(35,36)23(37,38)39/h2-3,9,11,13H,4,6H2,1H3/t9-,11?,13-/m1/s1 |
| InChIKey | JXIOAWGFXMUYNK-QSOGALPCSA-N |
| XLogP | 6.01 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.80 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|