C19H19ClN4O3 — CID 58595583
2-chloro-3-methyl-4-[(1R,6R)-8-(2-methylpropanoyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]benzonitrile (PubChem CID 58595583) has the molecular formula C19H19ClN4O3 and a molecular weight of 386.84 g/mol. Its IUPAC name is 2-chloro-3-methyl-4-[(1R,6R)-8-(2-methylpropanoyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]benzonitrile.
| Compound Name | 2-chloro-3-methyl-4-[(1R,6R)-8-(2-methylpropanoyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]benzonitrile |
|---|---|
| PubChem CID | 58595583 |
| Molecular Formula | C19H19ClN4O3 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 2-chloro-3-methyl-4-[(1R,6R)-8-(2-methylpropanoyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]benzonitrile |
| SMILES | Cc1c(N2C(=O)[C@H]3C4C[C@H](CN4C(=O)C(C)C)N3C2=O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C19H19ClN4O3/c1-9(2)17(25)22-8-12-6-14(22)16-18(26)24(19(27)23(12)16)13-5-4-11(7-21)15(20)10(13)3/h4-5,9,12,14,16H,6,8H2,1-3H3/t12-,14?,16-/m1/s1 |
| InChIKey | QTEVKGTXKKOHSL-QXDOLYAVSA-N |
| XLogP | 2.30 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|