C23H19BrClN5O3 — CID 23599151
(1S,6S,7S)-N-(4-bromo-3-methylphenyl)-4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide (PubChem CID 23599151) has the molecular formula C23H19BrClN5O3 and a molecular weight of 528.79 g/mol. Its IUPAC name is (1S,6S,7S)-N-(4-bromo-3-methylphenyl)-4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide.
| Compound Name | (1S,6S,7S)-N-(4-bromo-3-methylphenyl)-4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide |
|---|---|
| PubChem CID | 23599151 |
| Molecular Formula | C23H19BrClN5O3 |
| Molecular Weight | 528.79 g/mol |
| Exact Mass | 527.04 |
| IUPAC Name | (1S,6S,7S)-N-(4-bromo-3-methylphenyl)-4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide |
| SMILES | Cc1cc(NC(=O)N2C[C@@H]3C[C@H]2[C@H]2C(=O)N(c4ccc(C#N)c(Cl)c4C)C(=O)N32)ccc1Br |
| InChI | InChI=1S/C23H19BrClN5O3/c1-11-7-14(4-5-16(11)24)27-22(32)28-10-15-8-18(28)20-21(31)30(23(33)29(15)20)17-6-3-13(9-26)19(25)12(17)2/h3-7,15,18,20H,8,10H2,1-2H3,(H,27,32)/t15-,18-,20-/m0/s1 |
| InChIKey | VKIJTKWUVIGGDE-QSFXBCCZSA-N |
| XLogP | 4.42 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.79 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|