C29H23ClN4O3 — CID 71051541
2-chloro-4-[(1R,6S)-8-(2,2-diphenylacetyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbenzonitrile (PubChem CID 71051541) has the molecular formula C29H23ClN4O3 and a molecular weight of 510.98 g/mol. Its IUPAC name is 2-chloro-4-[(1R,6S)-8-(2,2-diphenylacetyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbenzonitrile.
| Compound Name | 2-chloro-4-[(1R,6S)-8-(2,2-diphenylacetyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 71051541 |
| Molecular Formula | C29H23ClN4O3 |
| Molecular Weight | 510.98 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 2-chloro-4-[(1R,6S)-8-(2,2-diphenylacetyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbenzonitrile |
| SMILES | Cc1c(N2C(=O)[C@@H]3C4C[C@H](CN4C(=O)C(c4ccccc4)c4ccccc4)N3C2=O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C29H23ClN4O3/c1-17-22(13-12-20(15-31)25(17)30)34-28(36)26-23-14-21(33(26)29(34)37)16-32(23)27(35)24(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-13,21,23-24,26H,14,16H2,1H3/t21-,23?,26+/m1/s1 |
| InChIKey | XYYOBYORJSWDLY-HEEQAANPSA-N |
| XLogP | 4.47 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.98 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|