C24H16ClF6N5O3 — CID 23599148
(1S,6S,7S)-N-[3,5-bis(trifluoromethyl)phenyl]-4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide (PubChem CID 23599148) has the molecular formula C24H16ClF6N5O3 and a molecular weight of 571.87 g/mol. Its IUPAC name is (1S,6S,7S)-N-[3,5-bis(trifluoromethyl)phenyl]-4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide.
| Compound Name | (1S,6S,7S)-N-[3,5-bis(trifluoromethyl)phenyl]-4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide |
|---|---|
| PubChem CID | 23599148 |
| Molecular Formula | C24H16ClF6N5O3 |
| Molecular Weight | 571.87 g/mol |
| Exact Mass | 571.08 |
| IUPAC Name | (1S,6S,7S)-N-[3,5-bis(trifluoromethyl)phenyl]-4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide |
| SMILES | Cc1c(N2C(=O)[C@@H]3[C@@H]4C[C@@H](CN4C(=O)Nc4cc(C(F)(F)F)cc(C(F)(F)F)c4)N3C2=O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C24H16ClF6N5O3/c1-10-16(3-2-11(8-32)18(10)25)36-20(37)19-17-7-15(35(19)22(36)39)9-34(17)21(38)33-14-5-12(23(26,27)28)4-13(6-14)24(29,30)31/h2-6,15,17,19H,7,9H2,1H3,(H,33,38)/t15-,17-,19-/m0/s1 |
| InChIKey | GYZDGEZCKGGZTG-IEZWGBDMSA-N |
| XLogP | 5.38 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.87 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|