C16H13ClN4O4 — CID 23599068
(1S,6S,7S)-4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylic acid (PubChem CID 23599068) has the molecular formula C16H13ClN4O4 and a molecular weight of 360.76 g/mol. Its IUPAC name is (1S,6S,7S)-4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylic acid.
| Compound Name | (1S,6S,7S)-4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylic acid |
|---|---|
| PubChem CID | 23599068 |
| Molecular Formula | C16H13ClN4O4 |
| Molecular Weight | 360.76 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | (1S,6S,7S)-4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylic acid |
| SMILES | Cc1c(N2C(=O)[C@@H]3[C@@H]4C[C@@H](CN4C(=O)O)N3C2=O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C16H13ClN4O4/c1-7-10(3-2-8(5-18)12(7)17)21-14(22)13-11-4-9(20(13)15(21)23)6-19(11)16(24)25/h2-3,9,11,13H,4,6H2,1H3,(H,24,25)/t9-,11-,13-/m0/s1 |
| InChIKey | FCKQMVXKWYFCFP-GAFUQQFSSA-N |
| XLogP | 1.79 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.76 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|