C22H17ClN6O5 — CID 58595696
(1R,6R)-4-(3-chloro-4-cyano-2-methylphenyl)-N-(3-nitrophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide (PubChem CID 58595696) has the molecular formula C22H17ClN6O5 and a molecular weight of 480.87 g/mol. Its IUPAC name is (1R,6R)-4-(3-chloro-4-cyano-2-methylphenyl)-N-(3-nitrophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide.
| Compound Name | (1R,6R)-4-(3-chloro-4-cyano-2-methylphenyl)-N-(3-nitrophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide |
|---|---|
| PubChem CID | 58595696 |
| Molecular Formula | C22H17ClN6O5 |
| Molecular Weight | 480.87 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | (1R,6R)-4-(3-chloro-4-cyano-2-methylphenyl)-N-(3-nitrophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide |
| SMILES | Cc1c(N2C(=O)[C@H]3C4C[C@H](CN4C(=O)Nc4cccc([N+](=O)[O-])c4)N3C2=O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C22H17ClN6O5/c1-11-16(6-5-12(9-24)18(11)23)28-20(30)19-17-8-15(27(19)22(28)32)10-26(17)21(31)25-13-3-2-4-14(7-13)29(33)34/h2-7,15,17,19H,8,10H2,1H3,(H,25,31)/t15-,17?,19-/m1/s1 |
| InChIKey | QQFAPNWDWNNXDQ-WUKPUPCQSA-N |
| XLogP | 3.25 |
| TPSA | 139.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.87 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|