C25H21N5O5 — CID 22244344
N-(4-methyl-3-nitrophenyl)-4-naphthalen-1-yl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide (PubChem CID 22244344) has the molecular formula C25H21N5O5 and a molecular weight of 471.47 g/mol. Its IUPAC name is N-(4-methyl-3-nitrophenyl)-4-naphthalen-1-yl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide.
| Compound Name | N-(4-methyl-3-nitrophenyl)-4-naphthalen-1-yl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide |
|---|---|
| PubChem CID | 22244344 |
| Molecular Formula | C25H21N5O5 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | N-(4-methyl-3-nitrophenyl)-4-naphthalen-1-yl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CC3CC2C2C(=O)N(c4cccc5ccccc45)C(=O)N32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H21N5O5/c1-14-9-10-16(11-20(14)30(34)35)26-24(32)27-13-17-12-21(27)22-23(31)29(25(33)28(17)22)19-8-4-6-15-5-2-3-7-18(15)19/h2-11,17,21-22H,12-13H2,1H3,(H,26,32) |
| InChIKey | OXTOICFRDCHITA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|