C26H24N4O5 — CID 58595627
(1R,6R)-N-(3,5-dimethoxyphenyl)-4-naphthalen-1-yl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide (PubChem CID 58595627) has the molecular formula C26H24N4O5 and a molecular weight of 472.50 g/mol. Its IUPAC name is (1R,6R)-N-(3,5-dimethoxyphenyl)-4-naphthalen-1-yl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide.
| Compound Name | (1R,6R)-N-(3,5-dimethoxyphenyl)-4-naphthalen-1-yl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide |
|---|---|
| PubChem CID | 58595627 |
| Molecular Formula | C26H24N4O5 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | (1R,6R)-N-(3,5-dimethoxyphenyl)-4-naphthalen-1-yl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide |
| SMILES | COc1cc(NC(=O)N2C[C@H]3CC2[C@@H]2C(=O)N(c4cccc5ccccc45)C(=O)N32)cc(OC)c1 |
| InChI | InChI=1S/C26H24N4O5/c1-34-18-10-16(11-19(13-18)35-2)27-25(32)28-14-17-12-22(28)23-24(31)30(26(33)29(17)23)21-9-5-7-15-6-3-4-8-20(15)21/h3-11,13,17,22-23H,12,14H2,1-2H3,(H,27,32)/t17-,22?,23-/m1/s1 |
| InChIKey | YDTQXXVNWNVIFG-NUQQNKIWSA-N |
| XLogP | 3.68 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|