C25H21N3O5 — CID 23599362
(4-methoxyphenyl) 4-naphthalen-1-yl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylate (PubChem CID 23599362) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is (4-methoxyphenyl) 4-naphthalen-1-yl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylate.
| Compound Name | (4-methoxyphenyl) 4-naphthalen-1-yl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylate |
|---|---|
| PubChem CID | 23599362 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | (4-methoxyphenyl) 4-naphthalen-1-yl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylate |
| SMILES | COc1ccc(OC(=O)N2CC3CC2C2C(=O)N(c4cccc5ccccc45)C(=O)N32)cc1 |
| InChI | InChI=1S/C25H21N3O5/c1-32-17-9-11-18(12-10-17)33-25(31)26-14-16-13-21(26)22-23(29)28(24(30)27(16)22)20-8-4-6-15-5-2-3-7-19(15)20/h2-12,16,21-22H,13-14H2,1H3 |
| InChIKey | CTHOVGQKAOZQIE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|