C24H18BrN3O3 — CID 22244339
8-(3-bromobenzoyl)-4-naphthalen-1-yl-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 22244339) has the molecular formula C24H18BrN3O3 and a molecular weight of 476.33 g/mol. Its IUPAC name is 8-(3-bromobenzoyl)-4-naphthalen-1-yl-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | 8-(3-bromobenzoyl)-4-naphthalen-1-yl-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 22244339 |
| Molecular Formula | C24H18BrN3O3 |
| Molecular Weight | 476.33 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | 8-(3-bromobenzoyl)-4-naphthalen-1-yl-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1C2C3CC(CN3C(=O)c3cccc(Br)c3)N2C(=O)N1c1cccc2ccccc12 |
| InChI | InChI=1S/C24H18BrN3O3/c25-16-8-3-7-15(11-16)22(29)26-13-17-12-20(26)21-23(30)28(24(31)27(17)21)19-10-4-6-14-5-1-2-9-18(14)19/h1-11,17,20-21H,12-13H2 |
| InChIKey | DKODUHFXZXGOIU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|