C25H21ClN4O3 — CID 71058802
(1R,6S)-N-(3-chloro-5-methylphenyl)-4-naphthalen-1-yl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide (PubChem CID 71058802) has the molecular formula C25H21ClN4O3 and a molecular weight of 460.92 g/mol. Its IUPAC name is (1R,6S)-N-(3-chloro-5-methylphenyl)-4-naphthalen-1-yl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide.
| Compound Name | (1R,6S)-N-(3-chloro-5-methylphenyl)-4-naphthalen-1-yl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide |
|---|---|
| PubChem CID | 71058802 |
| Molecular Formula | C25H21ClN4O3 |
| Molecular Weight | 460.92 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | (1R,6S)-N-(3-chloro-5-methylphenyl)-4-naphthalen-1-yl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide |
| SMILES | Cc1cc(Cl)cc(NC(=O)N2C[C@H]3CC2[C@H]2C(=O)N(c4cccc5ccccc45)C(=O)N32)c1 |
| InChI | InChI=1S/C25H21ClN4O3/c1-14-9-16(26)11-17(10-14)27-24(32)28-13-18-12-21(28)22-23(31)30(25(33)29(18)22)20-8-4-6-15-5-2-3-7-19(15)20/h2-11,18,21-22H,12-13H2,1H3,(H,27,32)/t18-,21?,22+/m1/s1 |
| InChIKey | PLTPFRVMOUAYMA-BYHNSMNUSA-N |
| XLogP | 4.63 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.92 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|