C25H20N4O4S — CID 58595524
(1R,6R)-N-(1,3-benzodioxol-5-yl)-4-naphthalen-1-yl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide (PubChem CID 58595524) has the molecular formula C25H20N4O4S and a molecular weight of 472.53 g/mol. Its IUPAC name is (1R,6R)-N-(1,3-benzodioxol-5-yl)-4-naphthalen-1-yl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide.
| Compound Name | (1R,6R)-N-(1,3-benzodioxol-5-yl)-4-naphthalen-1-yl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide |
|---|---|
| PubChem CID | 58595524 |
| Molecular Formula | C25H20N4O4S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | (1R,6R)-N-(1,3-benzodioxol-5-yl)-4-naphthalen-1-yl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide |
| SMILES | O=C1[C@H]2C3C[C@H](CN3C(=S)Nc3ccc4c(c3)OCO4)N2C(=O)N1c1cccc2ccccc12 |
| InChI | InChI=1S/C25H20N4O4S/c30-23-22-19-11-16(12-27(19)24(34)26-15-8-9-20-21(10-15)33-13-32-20)28(22)25(31)29(23)18-7-3-5-14-4-1-2-6-17(14)18/h1-10,16,19,22H,11-13H2,(H,26,34)/t16-,19?,22-/m1/s1 |
| InChIKey | BRPMJOMCNXXFDE-ZDUIXAHXSA-N |
| XLogP | 3.56 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|