C26H22N4O4S — CID 91222780
(1S,7S)-N-(1,3-benzodioxol-5-ylmethyl)-5-hydroxy-4-naphthalen-1-yl-3-oxo-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-ene-8-carbothioamide (PubChem CID 91222780) has the molecular formula C26H22N4O4S and a molecular weight of 486.55 g/mol. Its IUPAC name is (1S,7S)-N-(1,3-benzodioxol-5-ylmethyl)-5-hydroxy-4-naphthalen-1-yl-3-oxo-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-ene-8-carbothioamide.
| Compound Name | (1S,7S)-N-(1,3-benzodioxol-5-ylmethyl)-5-hydroxy-4-naphthalen-1-yl-3-oxo-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-ene-8-carbothioamide |
|---|---|
| PubChem CID | 91222780 |
| Molecular Formula | C26H22N4O4S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | (1S,7S)-N-(1,3-benzodioxol-5-ylmethyl)-5-hydroxy-4-naphthalen-1-yl-3-oxo-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-ene-8-carbothioamide |
| SMILES | O=c1n(-c2cccc3ccccc23)c(O)c2n1[C@H]1C[C@@H]2N(C(=S)NCc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C26H22N4O4S/c31-24-23-20-11-17(13-28(20)25(35)27-12-15-8-9-21-22(10-15)34-14-33-21)29(23)26(32)30(24)19-7-3-5-16-4-1-2-6-18(16)19/h1-10,17,20,31H,11-14H2,(H,27,35)/t17-,20-/m0/s1 |
| InChIKey | BTMMPNDVPBOQCN-PXNSSMCTSA-N |
| XLogP | 3.60 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|