C21H15N5O6 — CID 90911444
(1S,7S)-5-hydroxy-4-(4-nitronaphthalen-1-yl)-8-(1,2-oxazole-5-carbonyl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-3-one (PubChem CID 90911444) has the molecular formula C21H15N5O6 and a molecular weight of 433.38 g/mol. Its IUPAC name is (1S,7S)-5-hydroxy-4-(4-nitronaphthalen-1-yl)-8-(1,2-oxazole-5-carbonyl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-3-one.
| Compound Name | (1S,7S)-5-hydroxy-4-(4-nitronaphthalen-1-yl)-8-(1,2-oxazole-5-carbonyl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-3-one |
|---|---|
| PubChem CID | 90911444 |
| Molecular Formula | C21H15N5O6 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | (1S,7S)-5-hydroxy-4-(4-nitronaphthalen-1-yl)-8-(1,2-oxazole-5-carbonyl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-3-one |
| SMILES | O=C(c1ccno1)N1C[C@@H]2C[C@H]1c1c(O)n(-c3ccc([N+](=O)[O-])c4ccccc34)c(=O)n12 |
| InChI | InChI=1S/C21H15N5O6/c27-19(17-7-8-22-32-17)23-10-11-9-16(23)18-20(28)25(21(29)24(11)18)14-5-6-15(26(30)31)13-4-2-1-3-12(13)14/h1-8,11,16,28H,9-10H2/t11-,16-/m0/s1 |
| InChIKey | DMEFNLUEKWEATF-ZBEGNZNMSA-N |
| XLogP | 2.54 |
| TPSA | 136.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|