C18H14N4O6 — CID 90882298
(1S,7S)-5-hydroxy-4-(4-nitronaphthalen-1-yl)-3-oxo-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-ene-8-carboxylic acid (PubChem CID 90882298) has the molecular formula C18H14N4O6 and a molecular weight of 382.33 g/mol. Its IUPAC name is (1S,7S)-5-hydroxy-4-(4-nitronaphthalen-1-yl)-3-oxo-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-ene-8-carboxylic acid.
| Compound Name | (1S,7S)-5-hydroxy-4-(4-nitronaphthalen-1-yl)-3-oxo-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-ene-8-carboxylic acid |
|---|---|
| PubChem CID | 90882298 |
| Molecular Formula | C18H14N4O6 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | (1S,7S)-5-hydroxy-4-(4-nitronaphthalen-1-yl)-3-oxo-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-ene-8-carboxylic acid |
| SMILES | O=C(O)N1C[C@@H]2C[C@H]1c1c(O)n(-c3ccc([N+](=O)[O-])c4ccccc34)c(=O)n12 |
| InChI | InChI=1S/C18H14N4O6/c23-16-15-14-7-9(8-19(14)18(25)26)20(15)17(24)21(16)12-5-6-13(22(27)28)11-4-2-1-3-10(11)12/h1-6,9,14,23H,7-8H2,(H,25,26)/t9-,14-/m0/s1 |
| InChIKey | HCSIWJHHSRLRSX-XPTSAGLGSA-N |
| XLogP | 2.39 |
| TPSA | 130.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|