C17H14N4O4 — CID 91009555
(1S,7S)-5-hydroxy-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-3-one (PubChem CID 91009555) has the molecular formula C17H14N4O4 and a molecular weight of 338.32 g/mol. Its IUPAC name is (1S,7S)-5-hydroxy-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-3-one.
| Compound Name | (1S,7S)-5-hydroxy-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-3-one |
|---|---|
| PubChem CID | 91009555 |
| Molecular Formula | C17H14N4O4 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (1S,7S)-5-hydroxy-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-3-one |
| SMILES | O=c1n(-c2ccc([N+](=O)[O-])c3ccccc23)c(O)c2n1[C@@H]1CN[C@H]2C1 |
| InChI | InChI=1S/C17H14N4O4/c22-16-15-12-7-9(8-18-12)19(15)17(23)20(16)13-5-6-14(21(24)25)11-4-2-1-3-10(11)13/h1-6,9,12,18,22H,7-8H2/t9-,12-/m0/s1 |
| InChIKey | SKJSDQYLMAHJQJ-CABZTGNLSA-N |
| XLogP | 2.00 |
| TPSA | 102.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|