C23H16ClN5O8S — CID 91435193
(1S,7S)-8-(4-chloro-3-nitrophenyl)sulfonyl-5-hydroxy-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-3-one (PubChem CID 91435193) has the molecular formula C23H16ClN5O8S and a molecular weight of 557.93 g/mol. Its IUPAC name is (1S,7S)-8-(4-chloro-3-nitrophenyl)sulfonyl-5-hydroxy-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-3-one.
| Compound Name | (1S,7S)-8-(4-chloro-3-nitrophenyl)sulfonyl-5-hydroxy-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-3-one |
|---|---|
| PubChem CID | 91435193 |
| Molecular Formula | C23H16ClN5O8S |
| Molecular Weight | 557.93 g/mol |
| Exact Mass | 557.04 |
| IUPAC Name | (1S,7S)-8-(4-chloro-3-nitrophenyl)sulfonyl-5-hydroxy-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-3-one |
| SMILES | O=c1n(-c2ccc([N+](=O)[O-])c3ccccc23)c(O)c2n1[C@H]1C[C@@H]2N(S(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C23H16ClN5O8S/c24-16-6-5-13(10-19(16)29(34)35)38(36,37)25-11-12-9-20(25)21-22(30)27(23(31)26(12)21)17-7-8-18(28(32)33)15-4-2-1-3-14(15)17/h1-8,10,12,20,30H,9,11H2/t12-,20-/m0/s1 |
| InChIKey | QJKOKAZLURQSHJ-YUNKPMOVSA-N |
| XLogP | 3.66 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.93 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|