C23H17FN4O6S — CID 68891671
(1R,6S,7R)-8-(4-fluorophenyl)sulfonyl-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 68891671) has the molecular formula C23H17FN4O6S and a molecular weight of 496.48 g/mol. Its IUPAC name is (1R,6S,7R)-8-(4-fluorophenyl)sulfonyl-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,6S,7R)-8-(4-fluorophenyl)sulfonyl-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 68891671 |
| Molecular Formula | C23H17FN4O6S |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | (1R,6S,7R)-8-(4-fluorophenyl)sulfonyl-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H]3C[C@H](CN3S(=O)(=O)c3ccc(F)cc3)N2C(=O)N1c1ccc([N+](=O)[O-])c2ccccc12 |
| InChI | InChI=1S/C23H17FN4O6S/c24-13-5-7-15(8-6-13)35(33,34)25-12-14-11-20(25)21-22(29)27(23(30)26(14)21)18-9-10-19(28(31)32)17-4-2-1-3-16(17)18/h1-10,14,20-21H,11-12H2/t14-,20-,21+/m1/s1 |
| InChIKey | SCCDIFPFFSGHPC-IFZYUDKTSA-N |
| XLogP | 2.87 |
| TPSA | 121.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|