C23H16FN5O4S — CID 23599102
5-[(1S,6S,7S)-8-(2-fluorophenyl)sulfonyl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]quinoline-8-carbonitrile (PubChem CID 23599102) has the molecular formula C23H16FN5O4S and a molecular weight of 477.48 g/mol. Its IUPAC name is 5-[(1S,6S,7S)-8-(2-fluorophenyl)sulfonyl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(1S,6S,7S)-8-(2-fluorophenyl)sulfonyl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 23599102 |
| Molecular Formula | C23H16FN5O4S |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 5-[(1S,6S,7S)-8-(2-fluorophenyl)sulfonyl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]quinoline-8-carbonitrile |
| SMILES | N#Cc1ccc(N2C(=O)[C@@H]3[C@@H]4C[C@@H](CN4S(=O)(=O)c4ccccc4F)N3C2=O)c2cccnc12 |
| InChI | InChI=1S/C23H16FN5O4S/c24-16-5-1-2-6-19(16)34(32,33)27-12-14-10-18(27)21-22(30)29(23(31)28(14)21)17-8-7-13(11-25)20-15(17)4-3-9-26-20/h1-9,14,18,21H,10,12H2/t14-,18-,21-/m0/s1 |
| InChIKey | FBJXQPDFMHTODT-XQAUZQBESA-N |
| XLogP | 2.23 |
| TPSA | 114.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|