C19H18N6O4S — CID 23599112
(1S,6S,7S)-4-(8-cyanoquinolin-5-yl)-N,N-dimethyl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-sulfonamide (PubChem CID 23599112) has the molecular formula C19H18N6O4S and a molecular weight of 426.46 g/mol. Its IUPAC name is (1S,6S,7S)-4-(8-cyanoquinolin-5-yl)-N,N-dimethyl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-sulfonamide.
| Compound Name | (1S,6S,7S)-4-(8-cyanoquinolin-5-yl)-N,N-dimethyl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-sulfonamide |
|---|---|
| PubChem CID | 23599112 |
| Molecular Formula | C19H18N6O4S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | (1S,6S,7S)-4-(8-cyanoquinolin-5-yl)-N,N-dimethyl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1C[C@@H]2C[C@H]1[C@H]1C(=O)N(c3ccc(C#N)c4ncccc34)C(=O)N21 |
| InChI | InChI=1S/C19H18N6O4S/c1-22(2)30(28,29)23-10-12-8-15(23)17-18(26)25(19(27)24(12)17)14-6-5-11(9-20)16-13(14)4-3-7-21-16/h3-7,12,15,17H,8,10H2,1-2H3/t12-,15-,17-/m0/s1 |
| InChIKey | WJVRQJNSDXJERO-NUTKFTJISA-N |
| XLogP | 0.51 |
| TPSA | 117.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|