C25H12F15N5O3 — CID 89226639
5-[(1R,6S)-3,5-dioxo-8-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]quinoline-8-carbonitrile (PubChem CID 89226639) has the molecular formula C25H12F15N5O3 and a molecular weight of 715.37 g/mol. Its IUPAC name is 5-[(1R,6S)-3,5-dioxo-8-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(1R,6S)-3,5-dioxo-8-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 89226639 |
| Molecular Formula | C25H12F15N5O3 |
| Molecular Weight | 715.37 g/mol |
| Exact Mass | 715.07 |
| IUPAC Name | 5-[(1R,6S)-3,5-dioxo-8-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]quinoline-8-carbonitrile |
| SMILES | N#Cc1ccc(N2C(=O)[C@@H]3C4C[C@H](CN4C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)N3C2=O)c2cccnc12 |
| InChI | InChI=1S/C25H12F15N5O3/c26-19(27,20(28,29)21(30,31)22(32,33)23(34,35)24(36,37)25(38,39)40)17(47)43-8-10-6-13(43)15-16(46)45(18(48)44(10)15)12-4-3-9(7-41)14-11(12)2-1-5-42-14/h1-5,10,13,15H,6,8H2/t10-,13?,15+/m1/s1 |
| InChIKey | OVPAQSNEOSRIRU-HIHIVVGNSA-N |
| XLogP | 5.60 |
| TPSA | 97.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.37 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|