C24H19FN4O4 — CID 10297382
(6R)-8-(4-fluorobenzoyl)-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-5-one (PubChem CID 10297382) has the molecular formula C24H19FN4O4 and a molecular weight of 446.44 g/mol. Its IUPAC name is (6R)-8-(4-fluorobenzoyl)-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-5-one.
| Compound Name | (6R)-8-(4-fluorobenzoyl)-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-5-one |
|---|---|
| PubChem CID | 10297382 |
| Molecular Formula | C24H19FN4O4 |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | (6R)-8-(4-fluorobenzoyl)-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-5-one |
| SMILES | O=C1[C@H]2C3CC(CN3C(=O)c3ccc(F)cc3)N2CN1c1ccc([N+](=O)[O-])c2ccccc12 |
| InChI | InChI=1S/C24H19FN4O4/c25-15-7-5-14(6-8-15)23(30)26-12-16-11-21(26)22-24(31)28(13-27(16)22)19-9-10-20(29(32)33)18-4-2-1-3-17(18)19/h1-10,16,21-22H,11-13H2/t16?,21?,22-/m1/s1 |
| InChIKey | PVZOQHUIZJGTJE-UVOAEELBSA-N |
| XLogP | 3.16 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|