C24H18N4O5 — CID 90895660
(1R,7R)-8-benzoyl-5-hydroxy-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-3-one (PubChem CID 90895660) has the molecular formula C24H18N4O5 and a molecular weight of 442.43 g/mol. Its IUPAC name is (1R,7R)-8-benzoyl-5-hydroxy-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-3-one.
| Compound Name | (1R,7R)-8-benzoyl-5-hydroxy-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-3-one |
|---|---|
| PubChem CID | 90895660 |
| Molecular Formula | C24H18N4O5 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | (1R,7R)-8-benzoyl-5-hydroxy-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-3-one |
| SMILES | O=C(c1ccccc1)N1C[C@H]2C[C@@H]1c1c(O)n(-c3ccc([N+](=O)[O-])c4ccccc34)c(=O)n12 |
| InChI | InChI=1S/C24H18N4O5/c29-22(14-6-2-1-3-7-14)25-13-15-12-20(25)21-23(30)27(24(31)26(15)21)18-10-11-19(28(32)33)17-9-5-4-8-16(17)18/h1-11,15,20,30H,12-13H2/t15-,20-/m1/s1 |
| InChIKey | WLVVMACVNPURAP-FOIQADDNSA-N |
| XLogP | 3.55 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|