C15H20N2O2S — CID 7941796
(2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-methylpiperidine-1-carbothioamide (PubChem CID 7941796) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is (2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-methylpiperidine-1-carbothioamide.
| Compound Name | (2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-methylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 7941796 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | (2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-methylpiperidine-1-carbothioamide |
| SMILES | C[C@H]1CCCCN1C(=S)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H20N2O2S/c1-11-4-2-3-7-17(11)15(20)16-9-12-5-6-13-14(8-12)19-10-18-13/h5-6,8,11H,2-4,7,9-10H2,1H3,(H,16,20)/t11-/m0/s1 |
| InChIKey | QXSFXPWTTZOZKP-NSHDSACASA-N |
| XLogP | 2.66 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|