C16H23N3O2S — CID 8655274
1-(1,3-benzodioxol-5-ylmethyl)-3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]thiourea (PubChem CID 8655274) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]thiourea |
|---|---|
| PubChem CID | 8655274 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]thiourea |
| SMILES | C[C@@H]1CCC[C@H](C)N1NC(=S)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H23N3O2S/c1-11-4-3-5-12(2)19(11)18-16(22)17-9-13-6-7-14-15(8-13)21-10-20-14/h6-8,11-12H,3-5,9-10H2,1-2H3,(H2,17,18,22)/t11-,12+ |
| InChIKey | PFYCBICOUKWHTQ-TXEJJXNPSA-N |
| XLogP | 2.56 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|