C14H18N2O3S — CID 971591
(2S,6S)-N-(1,3-benzodioxol-5-yl)-2,6-dimethylmorpholine-4-carbothioamide (PubChem CID 971591) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is (2S,6S)-N-(1,3-benzodioxol-5-yl)-2,6-dimethylmorpholine-4-carbothioamide.
| Compound Name | (2S,6S)-N-(1,3-benzodioxol-5-yl)-2,6-dimethylmorpholine-4-carbothioamide |
|---|---|
| PubChem CID | 971591 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (2S,6S)-N-(1,3-benzodioxol-5-yl)-2,6-dimethylmorpholine-4-carbothioamide |
| SMILES | C[C@H]1CN(C(=S)Nc2ccc3c(c2)OCO3)C[C@H](C)O1 |
| InChI | InChI=1S/C14H18N2O3S/c1-9-6-16(7-10(2)19-9)14(20)15-11-3-4-12-13(5-11)18-8-17-12/h3-5,9-10H,6-8H2,1-2H3,(H,15,20)/t9-,10-/m0/s1 |
| InChIKey | UAOHXXAJJDHNNC-UWVGGRQHSA-N |
| XLogP | 2.22 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|