C20H23N3O3S — CID 5302085
4-(1,3-benzodioxol-5-ylamino)-N-(4-methoxyphenyl)piperidine-1-carbothioamide (PubChem CID 5302085) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylamino)-N-(4-methoxyphenyl)piperidine-1-carbothioamide.
| Compound Name | 4-(1,3-benzodioxol-5-ylamino)-N-(4-methoxyphenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 5302085 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylamino)-N-(4-methoxyphenyl)piperidine-1-carbothioamide |
| SMILES | COc1ccc(NC(=S)N2CCC(Nc3ccc4c(c3)OCO4)CC2)cc1 |
| InChI | InChI=1S/C20H23N3O3S/c1-24-17-5-2-14(3-6-17)22-20(27)23-10-8-15(9-11-23)21-16-4-7-18-19(12-16)26-13-25-18/h2-7,12,15,21H,8-11,13H2,1H3,(H,22,27) |
| InChIKey | MOHQOBPWZNZVSH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 54.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|