C20H23N3O5S2 — CID 17375192
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(4-methoxyphenyl)sulfonylpiperazine-1-carbothioamide (PubChem CID 17375192) has the molecular formula C20H23N3O5S2 and a molecular weight of 449.55 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(4-methoxyphenyl)sulfonylpiperazine-1-carbothioamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(4-methoxyphenyl)sulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17375192 |
| Molecular Formula | C20H23N3O5S2 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(4-methoxyphenyl)sulfonylpiperazine-1-carbothioamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=S)Nc3ccc4c(c3)OCCO4)CC2)cc1 |
| InChI | InChI=1S/C20H23N3O5S2/c1-26-16-3-5-17(6-4-16)30(24,25)23-10-8-22(9-11-23)20(29)21-15-2-7-18-19(14-15)28-13-12-27-18/h2-7,14H,8-13H2,1H3,(H,21,29) |
| InChIKey | GHFXPPCLXCMPSL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|