C19H18N4O2S — CID 3456677
N-(1,3-benzodioxol-5-yl)-4-(4-cyanophenyl)piperazine-1-carbothioamide (PubChem CID 3456677) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-4-(4-cyanophenyl)piperazine-1-carbothioamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-4-(4-cyanophenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3456677 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-4-(4-cyanophenyl)piperazine-1-carbothioamide |
| SMILES | N#Cc1ccc(N2CCN(C(=S)Nc3ccc4c(c3)OCO4)CC2)cc1 |
| InChI | InChI=1S/C19H18N4O2S/c20-12-14-1-4-16(5-2-14)22-7-9-23(10-8-22)19(26)21-15-3-6-17-18(11-15)25-13-24-17/h1-6,11H,7-10,13H2,(H,21,26) |
| InChIKey | OIYDKNQJEUIKMI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 60.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|