C15H18N2O4S — CID 18823179
N-(2,6-dimethylmorpholine-4-carbothioyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 18823179) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is N-(2,6-dimethylmorpholine-4-carbothioyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(2,6-dimethylmorpholine-4-carbothioyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 18823179 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-(2,6-dimethylmorpholine-4-carbothioyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | CC1CN(C(=S)NC(=O)c2ccc3c(c2)OCO3)CC(C)O1 |
| InChI | InChI=1S/C15H18N2O4S/c1-9-6-17(7-10(2)21-9)15(22)16-14(18)11-3-4-12-13(5-11)20-8-19-12/h3-5,9-10H,6-8H2,1-2H3,(H,16,18,22) |
| InChIKey | AJUNLUBXOBWDPO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|