C14H17ClN2O2S — CID 695632
2-chloro-N-[(2S,6S)-2,6-dimethylmorpholine-4-carbothioyl]benzamide (PubChem CID 695632) has the molecular formula C14H17ClN2O2S and a molecular weight of 312.82 g/mol. Its IUPAC name is 2-chloro-N-[(2S,6S)-2,6-dimethylmorpholine-4-carbothioyl]benzamide.
| Compound Name | 2-chloro-N-[(2S,6S)-2,6-dimethylmorpholine-4-carbothioyl]benzamide |
|---|---|
| PubChem CID | 695632 |
| Molecular Formula | C14H17ClN2O2S |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-chloro-N-[(2S,6S)-2,6-dimethylmorpholine-4-carbothioyl]benzamide |
| SMILES | C[C@H]1CN(C(=S)NC(=O)c2ccccc2Cl)C[C@H](C)O1 |
| InChI | InChI=1S/C14H17ClN2O2S/c1-9-7-17(8-10(2)19-9)14(20)16-13(18)11-5-3-4-6-12(11)15/h3-6,9-10H,7-8H2,1-2H3,(H,16,18,20)/t9-,10-/m0/s1 |
| InChIKey | JUQBSNGPFMIQBC-UWVGGRQHSA-N |
| XLogP | 2.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|